C31H39ILiNO4 — CID 176693240
lithium (4aS,6aR,6bS,8aS,12aR,14aR)-11-cyano-8a-iodo-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,14a-octahydropicen-14b-ide-4a-carboxylic acid (PubChem CID 176693240) has the molecular formula C31H39ILiNO4 and a molecular weight of 623.50 g/mol. Its IUPAC name is lithium (4aS,6aR,6bS,8aS,12aR,14aR)-11-cyano-8a-iodo-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,14a-octahydropicen-14b-ide-4a-carboxylic acid.
| Compound Name | lithium (4aS,6aR,6bS,8aS,12aR,14aR)-11-cyano-8a-iodo-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,14a-octahydropicen-14b-ide-4a-carboxylic acid |
|---|---|
| PubChem CID | 176693240 |
| Molecular Formula | C31H39ILiNO4 |
| Molecular Weight | 623.50 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | lithium (4aS,6aR,6bS,8aS,12aR,14aR)-11-cyano-8a-iodo-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,14a-octahydropicen-14b-ide-4a-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@]5(I)CC[C@]43C)[C-]2C1.[Li+] |
| InChI | InChI=1S/C31H39INO4.Li/c1-25(2)8-11-30(24(36)37)12-9-28(6)22(19(30)16-25)20(34)14-21-27(28,5)10-13-31(32)26(3,4)23(35)18(17-33)15-29(21,31)7;/h14-15,22H,8-13,16H2,1-7H3,(H,36,37);/q-1;+1/t22-,27+,28+,29+,30-,31+;/m0./s1 |
| InChIKey | RKPHQIDRXMWXDQ-JKWNMLTQSA-N |
| XLogP | 3.81 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|