C35H49LiN2O3 — CID 156798273
lithium (6aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(morpholin-4-ylmethyl)-3,13-dioxo-5,6,6a,7,8,9,10,12-octahydro-4aH-picen-12a-ide-2-carbonitrile (PubChem CID 156798273) has the molecular formula C35H49LiN2O3 and a molecular weight of 552.73 g/mol. Its IUPAC name is lithium (6aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(morpholin-4-ylmethyl)-3,13-dioxo-5,6,6a,7,8,9,10,12-octahydro-4aH-picen-12a-ide-2-carbonitrile.
| Compound Name | lithium (6aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(morpholin-4-ylmethyl)-3,13-dioxo-5,6,6a,7,8,9,10,12-octahydro-4aH-picen-12a-ide-2-carbonitrile |
|---|---|
| PubChem CID | 156798273 |
| Molecular Formula | C35H49LiN2O3 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.39 |
| IUPAC Name | lithium (6aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(morpholin-4-ylmethyl)-3,13-dioxo-5,6,6a,7,8,9,10,12-octahydro-4aH-picen-12a-ide-2-carbonitrile |
| SMILES | CC1(C)CC[C@]2(CN3CCOCC3)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)C5CC[C@]43C)[C-]2C1.[Li+] |
| InChI | InChI=1S/C35H49N2O3.Li/c1-30(2)10-12-35(22-37-14-16-40-17-15-37)13-11-34(7)28(24(35)20-30)25(38)18-27-32(5)19-23(21-36)29(39)31(3,4)26(32)8-9-33(27,34)6;/h18-19,26,28H,8-17,20,22H2,1-7H3;/q-1;+1/t26?,28-,32-,33+,34+,35+;/m0./s1 |
| InChIKey | KBZKKVLXNJKXPT-BVZZNSPMSA-N |
| XLogP | 3.50 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|