C34H49N3O3 — CID 156517276
1-[[(4aS,6aR,6bS,12aS,14aS,14bS)-11-cyano-2,2,6a,6b,9,9,12a,14b-octamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14a-octahydro-1H-picen-4a-yl]methyl]-3-methylurea (PubChem CID 156517276) has the molecular formula C34H49N3O3 and a molecular weight of 547.78 g/mol. Its IUPAC name is 1-[[(4aS,6aR,6bS,12aS,14aS,14bS)-11-cyano-2,2,6a,6b,9,9,12a,14b-octamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14a-octahydro-1H-picen-4a-yl]methyl]-3-methylurea.
| Compound Name | 1-[[(4aS,6aR,6bS,12aS,14aS,14bS)-11-cyano-2,2,6a,6b,9,9,12a,14b-octamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14a-octahydro-1H-picen-4a-yl]methyl]-3-methylurea |
|---|---|
| PubChem CID | 156517276 |
| Molecular Formula | C34H49N3O3 |
| Molecular Weight | 547.78 g/mol |
| Exact Mass | 547.38 |
| IUPAC Name | 1-[[(4aS,6aR,6bS,12aS,14aS,14bS)-11-cyano-2,2,6a,6b,9,9,12a,14b-octamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14a-octahydro-1H-picen-4a-yl]methyl]-3-methylurea |
| SMILES | CNC(=O)NC[C@]12CCC(C)(C)C[C@@]1(C)[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C34H49N3O3/c1-28(2)12-14-34(20-37-27(40)36-9)15-13-32(7)25(33(34,8)19-28)22(38)16-24-30(5)17-21(18-35)26(39)29(3,4)23(30)10-11-31(24,32)6/h16-17,23,25H,10-15,19-20H2,1-9H3,(H2,36,37,40)/t23?,25-,30-,31+,32+,33-,34+/m0/s1 |
| InChIKey | MENSDFPQQDLGNZ-BJLZAKPQSA-N |
| XLogP | 6.53 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.78 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |