C37H54N2O4 — CID 156798260
tert-butyl N-[[(4aS,6aR,6bS,8aR,12aS,14aS,14bS)-11-cyano-2,2,6a,6b,9,9,12a,14b-octamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14a-octahydro-1H-picen-4a-yl]methyl]carbamate (PubChem CID 156798260) has the molecular formula C37H54N2O4 and a molecular weight of 590.85 g/mol. Its IUPAC name is tert-butyl N-[[(4aS,6aR,6bS,8aR,12aS,14aS,14bS)-11-cyano-2,2,6a,6b,9,9,12a,14b-octamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14a-octahydro-1H-picen-4a-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(4aS,6aR,6bS,8aR,12aS,14aS,14bS)-11-cyano-2,2,6a,6b,9,9,12a,14b-octamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14a-octahydro-1H-picen-4a-yl]methyl]carbamate |
|---|---|
| PubChem CID | 156798260 |
| Molecular Formula | C37H54N2O4 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.41 |
| IUPAC Name | tert-butyl N-[[(4aS,6aR,6bS,8aR,12aS,14aS,14bS)-11-cyano-2,2,6a,6b,9,9,12a,14b-octamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14a-octahydro-1H-picen-4a-yl]methyl]carbamate |
| SMILES | CC1(C)CC[C@]2(CNC(=O)OC(C)(C)C)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@]2(C)C1 |
| InChI | InChI=1S/C37H54N2O4/c1-30(2,3)43-29(42)39-22-37-16-14-31(4,5)21-36(37,11)27-24(40)18-26-33(8)19-23(20-38)28(41)32(6,7)25(33)12-13-34(26,9)35(27,10)15-17-37/h18-19,25,27H,12-17,21-22H2,1-11H3,(H,39,42)/t25-,27-,33-,34+,35+,36-,37+/m0/s1 |
| InChIKey | AXLGOARJVYOFCK-INALYCAKSA-N |
| XLogP | 8.12 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |