C34H47LiN2O4 — CID 156798203
lithium (6aR,6bS,8aS,14bS)-6a-hydroxy-8a-[(3-hydroxyazetidin-1-yl)methyl]-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,7,8,9,10,12-octahydropicen-12a-ide-2-carbonitrile (PubChem CID 156798203) has the molecular formula C34H47LiN2O4 and a molecular weight of 554.70 g/mol. Its IUPAC name is lithium (6aR,6bS,8aS,14bS)-6a-hydroxy-8a-[(3-hydroxyazetidin-1-yl)methyl]-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,7,8,9,10,12-octahydropicen-12a-ide-2-carbonitrile.
| Compound Name | lithium (6aR,6bS,8aS,14bS)-6a-hydroxy-8a-[(3-hydroxyazetidin-1-yl)methyl]-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,7,8,9,10,12-octahydropicen-12a-ide-2-carbonitrile |
|---|---|
| PubChem CID | 156798203 |
| Molecular Formula | C34H47LiN2O4 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | lithium (6aR,6bS,8aS,14bS)-6a-hydroxy-8a-[(3-hydroxyazetidin-1-yl)methyl]-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-4a,5,6,7,8,9,10,12-octahydropicen-12a-ide-2-carbonitrile |
| SMILES | CC1(C)CC[C@]2(CN3CC(O)C3)CC[C@]3(C)C(O)(C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)C5CC[C@]43C)[C-]2C1.[Li+] |
| InChI | InChI=1S/C34H47N2O4.Li/c1-28(2)10-12-33(20-36-18-22(37)19-36)13-11-32(7)31(6)9-8-23-29(3,4)27(39)21(17-35)15-30(23,5)24(31)14-26(38)34(32,40)25(33)16-28;/h14-15,22-23,37,40H,8-13,16,18-20H2,1-7H3;/q-1;+1/t23?,30-,31+,32-,33+,34?;/m0./s1 |
| InChIKey | GKUFSDZTHYRGLC-ZPWGQKEVSA-N |
| XLogP | 1.96 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|