C32H45NO4 — CID 73335604
(4aR,6aR,6aS,6bS,8aS,14bS)-6a-hydroxy-8a-(methoxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-5,6,7,8,9,10,12,12a-octahydro-4aH-picene-2-carbonitrile (PubChem CID 73335604) has the molecular formula C32H45NO4 and a molecular weight of 507.72 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bS,8aS,14bS)-6a-hydroxy-8a-(methoxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-5,6,7,8,9,10,12,12a-octahydro-4aH-picene-2-carbonitrile.
| Compound Name | (4aR,6aR,6aS,6bS,8aS,14bS)-6a-hydroxy-8a-(methoxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-5,6,7,8,9,10,12,12a-octahydro-4aH-picene-2-carbonitrile |
|---|---|
| PubChem CID | 73335604 |
| Molecular Formula | C32H45NO4 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | (4aR,6aR,6aS,6bS,8aS,14bS)-6a-hydroxy-8a-(methoxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-5,6,7,8,9,10,12,12a-octahydro-4aH-picene-2-carbonitrile |
| SMILES | COC[C@]12CCC(C)(C)CC1[C@@]1(O)C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H45NO4/c1-26(2)11-13-31(19-37-8)14-12-30(7)29(6)10-9-21-27(3,4)25(35)20(18-33)16-28(21,5)22(29)15-24(34)32(30,36)23(31)17-26/h15-16,21,23,36H,9-14,17,19H2,1-8H3/t21-,23?,28-,29+,30-,31+,32+/m0/s1 |
| InChIKey | RFDARQJRJXCBTA-FOAHVPTJSA-N |
| XLogP | 5.97 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |