C31H43N2O4P — CID 146506163
[(1S,6S,11R,14R,15S,18S,23R)-8-cyano-6,10,10,14,15,21,21-heptamethyl-9-oxo-2-azahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosa-2,4,7-trien-18-yl]methylphosphonic acid (PubChem CID 146506163) has the molecular formula C31H43N2O4P and a molecular weight of 538.67 g/mol. Its IUPAC name is [(1S,6S,11R,14R,15S,18S,23R)-8-cyano-6,10,10,14,15,21,21-heptamethyl-9-oxo-2-azahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosa-2,4,7-trien-18-yl]methylphosphonic acid.
| Compound Name | [(1S,6S,11R,14R,15S,18S,23R)-8-cyano-6,10,10,14,15,21,21-heptamethyl-9-oxo-2-azahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosa-2,4,7-trien-18-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 146506163 |
| Molecular Formula | C31H43N2O4P |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | [(1S,6S,11R,14R,15S,18S,23R)-8-cyano-6,10,10,14,15,21,21-heptamethyl-9-oxo-2-azahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosa-2,4,7-trien-18-yl]methylphosphonic acid |
| SMILES | CC1(C)CC[C@]2(CP(=O)(O)O)CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)C(=O)C(C#N)=C[C@]5(C)C4=CC4=N[C@]43[C@@H]2C1 |
| InChI | InChI=1S/C31H43N2O4P/c1-25(2)10-12-30(18-38(35,36)37)13-11-29(7)28(6)9-8-20-26(3,4)24(34)19(17-32)15-27(20,5)21(28)14-23-31(29,33-23)22(30)16-25/h14-15,20,22H,8-13,16,18H2,1-7H3,(H2,35,36,37)/t20-,22+,27-,28+,29-,30+,31+/m0/s1 |
| InChIKey | JLTYBCBADVQEPB-RKZMEYFHSA-N |
| XLogP | 6.39 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|