C33H47NO5 — CID 90088002
methyl (1S,2R,5R,10S,14S,20S)-8-cyano-14-hydroxy-1,2,6,6,10,17,17,20-octamethyl-7,13-dioxotetracyclo[12.8.0.02,11.05,10]docosa-8,11-diene-20-carboxylate (PubChem CID 90088002) has the molecular formula C33H47NO5 and a molecular weight of 537.74 g/mol. Its IUPAC name is methyl (1S,2R,5R,10S,14S,20S)-8-cyano-14-hydroxy-1,2,6,6,10,17,17,20-octamethyl-7,13-dioxotetracyclo[12.8.0.02,11.05,10]docosa-8,11-diene-20-carboxylate.
| Compound Name | methyl (1S,2R,5R,10S,14S,20S)-8-cyano-14-hydroxy-1,2,6,6,10,17,17,20-octamethyl-7,13-dioxotetracyclo[12.8.0.02,11.05,10]docosa-8,11-diene-20-carboxylate |
|---|---|
| PubChem CID | 90088002 |
| Molecular Formula | C33H47NO5 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.35 |
| IUPAC Name | methyl (1S,2R,5R,10S,14S,20S)-8-cyano-14-hydroxy-1,2,6,6,10,17,17,20-octamethyl-7,13-dioxotetracyclo[12.8.0.02,11.05,10]docosa-8,11-diene-20-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC(C)(C)CC[C@@]2(O)C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]2(C)CC1 |
| InChI | InChI=1S/C33H47NO5/c1-27(2)12-14-29(5,26(37)39-9)15-16-32(8)31(7)11-10-22-28(3,4)25(36)21(20-34)19-30(22,6)23(31)18-24(35)33(32,38)17-13-27/h18-19,22,38H,10-17H2,1-9H3/t22-,29-,30-,31+,32-,33+/m0/s1 |
| InChIKey | WSRQEHSFUWEBBT-XSXYQVDFSA-N |
| XLogP | 6.27 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |