C35H50N2O4 — CID 90003930
11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(2-methylpropyl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 90003930) has the molecular formula C35H50N2O4 and a molecular weight of 562.80 g/mol. Its IUPAC name is 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(2-methylpropyl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(2-methylpropyl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 90003930 |
| Molecular Formula | C35H50N2O4 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(2-methylpropyl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | CC(C)CNC(=O)C1(C)CCC2(C)CCC3(C)C4(C)CCC5C(C)(C)C(=O)C(C#N)=CC5(C)C4=CC(=O)C3(O)C2C1 |
| InChI | InChI=1S/C35H50N2O4/c1-21(2)20-37-28(40)31(6)13-12-30(5)14-15-34(9)33(8)11-10-23-29(3,4)27(39)22(19-36)17-32(23,7)24(33)16-26(38)35(34,41)25(30)18-31/h16-17,21,23,25,41H,10-15,18,20H2,1-9H3,(H,37,40) |
| InChIKey | ATJCDKBRCYAAPK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |