C36H50N2O5 — CID 73387780
(2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(oxan-4-yl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 73387780) has the molecular formula C36H50N2O5 and a molecular weight of 590.81 g/mol. Its IUPAC name is (2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(oxan-4-yl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | (2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(oxan-4-yl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 73387780 |
| Molecular Formula | C36H50N2O5 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | (2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(oxan-4-yl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)[C@]4(O)[C@@H]5C[C@@](C)(C(=O)NC6CCOCC6)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C36H50N2O5/c1-30(2)24-8-11-34(6)25(33(24,5)19-22(21-37)28(30)40)18-27(39)36(42)26-20-32(4,29(41)38-23-9-16-43-17-10-23)13-12-31(26,3)14-15-35(34,36)7/h18-19,23-24,26,42H,8-17,20H2,1-7H3,(H,38,41)/t24-,26+,31+,32-,33-,34+,35-,36+/m0/s1 |
| InChIKey | MMJGMYDYDGADMC-NGVHBRROSA-N |
| XLogP | 5.62 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |