C35H46N4O4 — CID 140635617
11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(1H-pyrazol-5-ylmethyl)-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 140635617) has the molecular formula C35H46N4O4 and a molecular weight of 586.78 g/mol. Its IUPAC name is 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(1H-pyrazol-5-ylmethyl)-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(1H-pyrazol-5-ylmethyl)-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 140635617 |
| Molecular Formula | C35H46N4O4 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(1H-pyrazol-5-ylmethyl)-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | CC1(C(=O)NCc2ccn[nH]2)CCC2(C)CCC3(C)C4(C)CCC5C(C)(C)C(=O)C(C#N)=CC5(C)C4=CC(=O)C3(O)C2C1 |
| InChI | InChI=1S/C35H46N4O4/c1-29(2)23-8-10-33(6)24(32(23,5)17-21(19-36)27(29)41)16-26(40)35(43)25-18-31(4,28(42)37-20-22-9-15-38-39-22)12-11-30(25,3)13-14-34(33,35)7/h9,15-17,23,25,43H,8,10-14,18,20H2,1-7H3,(H,37,42)(H,38,39) |
| InChIKey | HREQNEIEYNLUIJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |