C36H52N2O4 — CID 90003294
11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(2-methylbutyl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 90003294) has the molecular formula C36H52N2O4 and a molecular weight of 576.82 g/mol. Its IUPAC name is 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(2-methylbutyl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(2-methylbutyl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 90003294 |
| Molecular Formula | C36H52N2O4 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.39 |
| IUPAC Name | 11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-N-(2-methylbutyl)-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | CCC(C)CNC(=O)C1(C)CCC2(C)CCC3(C)C4(C)CCC5C(C)(C)C(=O)C(C#N)=CC5(C)C4=CC(=O)C3(O)C2C1 |
| InChI | InChI=1S/C36H52N2O4/c1-10-22(2)21-38-29(41)32(6)14-13-31(5)15-16-35(9)34(8)12-11-24-30(3,4)28(40)23(20-37)18-33(24,7)25(34)17-27(39)36(35,42)26(31)19-32/h17-18,22,24,26,42H,10-16,19,21H2,1-9H3,(H,38,41) |
| InChIKey | QJJUWZDOOLXLSN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |