C31H44N2O6S — CID 140635641
methyl N-[(2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picen-2-yl]sulfamate (PubChem CID 140635641) has the molecular formula C31H44N2O6S and a molecular weight of 572.77 g/mol. Its IUPAC name is methyl N-[(2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picen-2-yl]sulfamate.
| Compound Name | methyl N-[(2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picen-2-yl]sulfamate |
|---|---|
| PubChem CID | 140635641 |
| Molecular Formula | C31H44N2O6S |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | methyl N-[(2S,4aS,6aS,6bR,8aR,12aS,14aS,14bR)-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picen-2-yl]sulfamate |
| SMILES | COS(=O)(=O)N[C@@]1(C)CC[C@]2(C)CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)C(=O)C(C#N)=C[C@]5(C)C4=CC(=O)[C@]3(O)[C@@H]2C1 |
| InChI | InChI=1S/C31H44N2O6S/c1-25(2)20-9-10-29(6)21(28(20,5)16-19(18-32)24(25)35)15-23(34)31(36)22-17-27(4,33-40(37,38)39-8)13-11-26(22,3)12-14-30(29,31)7/h15-16,20,22,33,36H,9-14,17H2,1-8H3/t20-,22+,26+,27-,28-,29+,30-,31+/m0/s1 |
| InChIKey | SRCMVPPQVDJOLG-WZZKSVHRSA-N |
| XLogP | 4.55 |
| TPSA | 133.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |