C35H49NO3 — CID 73335697
(1S,4S,5R,8R,13S,17S)-23-butyl-4,5,9,9,13,20,20-heptamethyl-10,16-dioxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosa-11,14-diene-11-carbonitrile (PubChem CID 73335697) has the molecular formula C35H49NO3 and a molecular weight of 531.78 g/mol. Its IUPAC name is (1S,4S,5R,8R,13S,17S)-23-butyl-4,5,9,9,13,20,20-heptamethyl-10,16-dioxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosa-11,14-diene-11-carbonitrile.
| Compound Name | (1S,4S,5R,8R,13S,17S)-23-butyl-4,5,9,9,13,20,20-heptamethyl-10,16-dioxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosa-11,14-diene-11-carbonitrile |
|---|---|
| PubChem CID | 73335697 |
| Molecular Formula | C35H49NO3 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.37 |
| IUPAC Name | (1S,4S,5R,8R,13S,17S)-23-butyl-4,5,9,9,13,20,20-heptamethyl-10,16-dioxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosa-11,14-diene-11-carbonitrile |
| SMILES | CCCCC1O[C@]23C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]2(C)CC[C@]12CCC(C)(C)CC23 |
| InChI | InChI=1S/C35H49NO3/c1-9-10-11-27-34-16-14-29(2,3)20-25(34)35(39-27)26(37)18-24-31(6)19-22(21-36)28(38)30(4,5)23(31)12-13-32(24,7)33(35,8)15-17-34/h18-19,23,25,27H,9-17,20H2,1-8H3/t23-,25?,27?,31-,32+,33-,34-,35+/m0/s1 |
| InChIKey | OUITXCFREXBTAX-ZVWNYAAXSA-N |
| XLogP | 7.92 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |