C36H53NO3 — CID 160858215
(1S,4S,5R,8R,13R,17S,18R)-23-butyl-11-isocyano-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosa-11,14-diene-10,16-dione;methane (PubChem CID 160858215) has the molecular formula C36H53NO3 and a molecular weight of 547.82 g/mol. Its IUPAC name is (1S,4S,5R,8R,13R,17S,18R)-23-butyl-11-isocyano-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosa-11,14-diene-10,16-dione;methane.
| Compound Name | (1S,4S,5R,8R,13R,17S,18R)-23-butyl-11-isocyano-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosa-11,14-diene-10,16-dione;methane |
|---|---|
| PubChem CID | 160858215 |
| Molecular Formula | C36H53NO3 |
| Molecular Weight | 547.82 g/mol |
| Exact Mass | 547.40 |
| IUPAC Name | (1S,4S,5R,8R,13R,17S,18R)-23-butyl-11-isocyano-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosa-11,14-diene-10,16-dione;methane |
| SMILES | C.[C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@]45OC(CCCC)[C@@]6(CCC(C)(C)C[C@H]64)CC[C@@]5(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C35H49NO3.CH4/c1-10-11-12-27-34-17-15-29(2,3)21-25(34)35(39-27)26(37)19-24-31(6)20-22(36-9)28(38)30(4,5)23(31)13-14-32(24,7)33(35,8)16-18-34;/h19-20,23,25,27H,10-18,21H2,1-8H3;1H4/t23-,25+,27?,31-,32+,33-,34-,35+;/m0./s1 |
| InChIKey | SKDJHBUUJJEJDA-RMTAAPPSSA-N |
| XLogP | 8.91 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.82 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|