C32H41NO4 — CID 140592372
CID 140592372 (PubChem CID 140592372) has the molecular formula C32H41NO4 and a molecular weight of 503.68 g/mol.
| Compound Name | CID 140592372 |
|---|---|
| PubChem CID | 140592372 |
| Molecular Formula | C32H41NO4 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C]4[C]5CC(C)(C)CC[C@]5(CC(=O)O)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C32H41NO4/c1-27(2)11-13-32(18-24(35)36)14-12-31(7)25(19(32)16-27)21(34)15-23-29(5)17-20(33-8)26(37)28(3,4)22(29)9-10-30(23,31)6/h15,17,22H,9-14,16,18H2,1-7H3,(H,35,36)/t22-,29-,30+,31+,32+/m0/s1 |
| InChIKey | TWXJOORYJNQEED-JDOPUXGMSA-N |
| XLogP | 6.95 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|