C31H39NO4 — CID 140592345
CID 140592345 (PubChem CID 140592345) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol.
| Compound Name | CID 140592345 |
|---|---|
| PubChem CID | 140592345 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C]4[C]5CC(C)(C)CC[C@]5(C(=O)O)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C31H39NO4/c1-26(2)11-13-31(25(35)36)14-12-30(7)23(18(31)16-26)20(33)15-22-28(5)17-19(32-8)24(34)27(3,4)21(28)9-10-29(22,30)6/h15,17,21H,9-14,16H2,1-7H3,(H,35,36)/t21-,28-,29+,30+,31-/m0/s1 |
| InChIKey | ZMRAIARCUGATDK-DLDSFRCWSA-N |
| XLogP | 6.56 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|