C35H45N3O3 — CID 140675934
CID 140675934 (PubChem CID 140675934) has the molecular formula C35H45N3O3 and a molecular weight of 555.76 g/mol.
| Compound Name | CID 140675934 |
|---|---|
| PubChem CID | 140675934 |
| Molecular Formula | C35H45N3O3 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.35 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C]4[C]5CC(C)(C)CC[C@]5(c5nnc(C(C)C)o5)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C35H45N3O3/c1-20(2)28-37-38-29(41-28)35-15-13-30(3,4)18-21(35)26-23(39)17-25-32(7)19-22(36-10)27(40)31(5,6)24(32)11-12-33(25,8)34(26,9)14-16-35/h17,19-20,24H,11-16,18H2,1-9H3/t24-,32-,33+,34+,35-/m0/s1 |
| InChIKey | NOXMKAXYRCPSLP-AKWKVZITSA-N |
| XLogP | 7.93 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|