C24H26N2O2Si — CID 24989260
3,7-diisocyano-1,1,4a-trimethyl-8a-(2-trimethylsilylethynyl)-10,10a-dihydro-9H-phenanthrene-2,6-dione (PubChem CID 24989260) has the molecular formula C24H26N2O2Si and a molecular weight of 402.57 g/mol. Its IUPAC name is 3,7-diisocyano-1,1,4a-trimethyl-8a-(2-trimethylsilylethynyl)-10,10a-dihydro-9H-phenanthrene-2,6-dione.
| Compound Name | 3,7-diisocyano-1,1,4a-trimethyl-8a-(2-trimethylsilylethynyl)-10,10a-dihydro-9H-phenanthrene-2,6-dione |
|---|---|
| PubChem CID | 24989260 |
| Molecular Formula | C24H26N2O2Si |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3,7-diisocyano-1,1,4a-trimethyl-8a-(2-trimethylsilylethynyl)-10,10a-dihydro-9H-phenanthrene-2,6-dione |
| SMILES | [C-]#[N+]C1=CC2(C#C[Si](C)(C)C)CCC3C(C)(C)C(=O)C([N+]#[C-])=CC3(C)C2=CC1=O |
| InChI | InChI=1S/C24H26N2O2Si/c1-22(2)19-9-10-24(11-12-29(6,7)8)15-16(25-4)18(27)13-20(24)23(19,3)14-17(26-5)21(22)28/h13-15,19H,9-10H2,1-3,6-8H3 |
| InChIKey | TXWYJXACHZBFAP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|