C26H26N2O2Si — CID 59301062
(4bR,8aR,10aS)-6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-(4-trimethylsilylbuta-1,3-diynyl)-9,10-dihydro-8aH-phenanthrene-2-carbonitrile (PubChem CID 59301062) has the molecular formula C26H26N2O2Si and a molecular weight of 426.59 g/mol. Its IUPAC name is (4bR,8aR,10aS)-6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-(4-trimethylsilylbuta-1,3-diynyl)-9,10-dihydro-8aH-phenanthrene-2-carbonitrile.
| Compound Name | (4bR,8aR,10aS)-6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-(4-trimethylsilylbuta-1,3-diynyl)-9,10-dihydro-8aH-phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 59301062 |
| Molecular Formula | C26H26N2O2Si |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (4bR,8aR,10aS)-6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-(4-trimethylsilylbuta-1,3-diynyl)-9,10-dihydro-8aH-phenanthrene-2-carbonitrile |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)C(C#N)=C[C@]3(C#CC#C[Si](C)(C)C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C26H26N2O2Si/c1-24(2)21-10-12-26(11-8-9-13-31(5,6)7)15-18(17-27)20(29)14-22(26)25(21,3)16-19(28-4)23(24)30/h14-16,21H,10,12H2,1-3,5-7H3/t21-,25-,26-/m0/s1 |
| InChIKey | JVFNNLMOIMXNCV-MZBJOSPHSA-N |
| XLogP | 4.64 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|