C44H40N4O4 — CID 159788955
6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-ynyl-9,10-dihydro-8aH-phenanthrene-2-carbonitrile (PubChem CID 159788955) has the molecular formula C44H40N4O4 and a molecular weight of 688.83 g/mol. Its IUPAC name is 6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-ynyl-9,10-dihydro-8aH-phenanthrene-2-carbonitrile.
| Compound Name | 6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-ynyl-9,10-dihydro-8aH-phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 159788955 |
| Molecular Formula | C44H40N4O4 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | 6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-ynyl-9,10-dihydro-8aH-phenanthrene-2-carbonitrile |
| SMILES | [C-]#[N+]C1=CC2(C)C3=CC(=O)C(C#N)=CC3(C#CC)CCC2C(C)(C)C1=O.[C-]#[N+]C1=CC2(C)C3=CC(=O)C(C#N)=CC3(C#CC)CCC2C(C)(C)C1=O |
| InChI | InChI=1S/2C22H20N2O2/c2*1-6-8-22-9-7-17-20(2,3)19(26)15(24-5)12-21(17,4)18(22)10-16(25)14(11-22)13-23/h2*10-12,17H,7,9H2,1-4H3 |
| InChIKey | NIHRENVTPQXEQH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 124.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|