C20H19N3O2 — CID 142265734
(10aR)-7-hydroxy-4b,8,8-trimethyl-3-oxo-7,8a,9,10-tetrahydrophenanthrene-2,6,10a-tricarbonitrile (PubChem CID 142265734) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (10aR)-7-hydroxy-4b,8,8-trimethyl-3-oxo-7,8a,9,10-tetrahydrophenanthrene-2,6,10a-tricarbonitrile.
| Compound Name | (10aR)-7-hydroxy-4b,8,8-trimethyl-3-oxo-7,8a,9,10-tetrahydrophenanthrene-2,6,10a-tricarbonitrile |
|---|---|
| PubChem CID | 142265734 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (10aR)-7-hydroxy-4b,8,8-trimethyl-3-oxo-7,8a,9,10-tetrahydrophenanthrene-2,6,10a-tricarbonitrile |
| SMILES | CC12C=C(C#N)C(O)C(C)(C)C1CC[C@@]1(C#N)C=C(C#N)C(=O)C=C21 |
| InChI | InChI=1S/C20H19N3O2/c1-18(2)15-4-5-20(11-23)8-12(9-21)14(24)6-16(20)19(15,3)7-13(10-22)17(18)25/h6-8,15,17,25H,4-5H2,1-3H3/t15?,17?,19?,20-/m0/s1 |
| InChIKey | NWLGGRLWQWALJF-OYQRTFSISA-N |
| XLogP | 2.72 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |