C19H20FNO2S — CID 143931258
(7-cyano-8a-ethynyl-1,4a-dimethyl-6-oxo-2,3,4,9,10,10a-hexahydro-1H-phenanthren-2-yl)oxy thiohypofluorite (PubChem CID 143931258) has the molecular formula C19H20FNO2S and a molecular weight of 345.44 g/mol. Its IUPAC name is (7-cyano-8a-ethynyl-1,4a-dimethyl-6-oxo-2,3,4,9,10,10a-hexahydro-1H-phenanthren-2-yl)oxy thiohypofluorite.
| Compound Name | (7-cyano-8a-ethynyl-1,4a-dimethyl-6-oxo-2,3,4,9,10,10a-hexahydro-1H-phenanthren-2-yl)oxy thiohypofluorite |
|---|---|
| PubChem CID | 143931258 |
| Molecular Formula | C19H20FNO2S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (7-cyano-8a-ethynyl-1,4a-dimethyl-6-oxo-2,3,4,9,10,10a-hexahydro-1H-phenanthren-2-yl)oxy thiohypofluorite |
| SMILES | C#CC12C=C(C#N)C(=O)C=C1C1(C)CCC(OSF)C(C)C1CC2 |
| InChI | InChI=1S/C19H20FNO2S/c1-4-19-8-5-14-12(2)16(23-24-20)6-7-18(14,3)17(19)9-15(22)13(10-19)11-21/h1,9-10,12,14,16H,5-8H2,2-3H3 |
| InChIKey | MXHYGKFLOPEDIH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|