C17H13NO — CID 145170732
10a-ethynyl-3-oxo-5,6,9,10-tetrahydrophenanthrene-2-carbonitrile (PubChem CID 145170732) has the molecular formula C17H13NO and a molecular weight of 247.30 g/mol. Its IUPAC name is 10a-ethynyl-3-oxo-5,6,9,10-tetrahydrophenanthrene-2-carbonitrile.
| Compound Name | 10a-ethynyl-3-oxo-5,6,9,10-tetrahydrophenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 145170732 |
| Molecular Formula | C17H13NO |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 10a-ethynyl-3-oxo-5,6,9,10-tetrahydrophenanthrene-2-carbonitrile |
| SMILES | C#CC12C=C(C#N)C(=O)C=C1C1=C(C=CCC1)CC2 |
| InChI | InChI=1S/C17H13NO/c1-2-17-8-7-12-5-3-4-6-14(12)15(17)9-16(19)13(10-17)11-18/h1,3,5,9-10H,4,6-8H2 |
| InChIKey | YHKYOORQCIHDTF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|