C22H23NO2 — CID 143681053
10a-ethynyl-4b,8-dimethyl-3,7-dioxo-6-propyl-8,8a,9,10-tetrahydrophenanthrene-2-carbonitrile (PubChem CID 143681053) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 10a-ethynyl-4b,8-dimethyl-3,7-dioxo-6-propyl-8,8a,9,10-tetrahydrophenanthrene-2-carbonitrile.
| Compound Name | 10a-ethynyl-4b,8-dimethyl-3,7-dioxo-6-propyl-8,8a,9,10-tetrahydrophenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 143681053 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 10a-ethynyl-4b,8-dimethyl-3,7-dioxo-6-propyl-8,8a,9,10-tetrahydrophenanthrene-2-carbonitrile |
| SMILES | C#CC12C=C(C#N)C(=O)C=C1C1(C)C=C(CCC)C(=O)C(C)C1CC2 |
| InChI | InChI=1S/C22H23NO2/c1-5-7-15-11-21(4)17(14(3)20(15)25)8-9-22(6-2)12-16(13-23)18(24)10-19(21)22/h2,10-12,14,17H,5,7-9H2,1,3-4H3 |
| InChIKey | IZZOFOVXNCXUAZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|