C30H41NO2 — CID 138567769
8a-ethyl-4,6a,11,11,14b-pentamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile (PubChem CID 138567769) has the molecular formula C30H41NO2 and a molecular weight of 447.66 g/mol. Its IUPAC name is 8a-ethyl-4,6a,11,11,14b-pentamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile.
| Compound Name | 8a-ethyl-4,6a,11,11,14b-pentamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 138567769 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | 8a-ethyl-4,6a,11,11,14b-pentamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2-carbonitrile |
| SMILES | CCC12CCC3C(C(=O)C=C4C5(C)C=C(C#N)C(=O)C(C)C5CCC43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C30H41NO2/c1-7-30-11-9-21-25(22(30)16-27(3,4)12-13-30)23(32)14-24-28(21,5)10-8-20-18(2)26(33)19(17-31)15-29(20,24)6/h14-15,18,20-22,25H,7-13,16H2,1-6H3 |
| InChIKey | NHUHZLDAVWTDEW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |