C31H41NO4 — CID 138567965
methyl 3-[(4aS)-11-cyano-2,2,6b,12a-tetramethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicen-4a-yl]propanoate (PubChem CID 138567965) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is methyl 3-[(4aS)-11-cyano-2,2,6b,12a-tetramethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicen-4a-yl]propanoate.
| Compound Name | methyl 3-[(4aS)-11-cyano-2,2,6b,12a-tetramethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicen-4a-yl]propanoate |
|---|---|
| PubChem CID | 138567965 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | methyl 3-[(4aS)-11-cyano-2,2,6b,12a-tetramethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicen-4a-yl]propanoate |
| SMILES | COC(=O)CC[C@@]12CCC3C(C(=O)C=C4C5(C)C=C(C#N)C(=O)CC5CCC43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C31H41NO4/c1-28(2)12-13-31(11-8-26(35)36-5)10-7-21-27(22(31)17-28)24(34)15-25-29(21,3)9-6-20-14-23(33)19(18-32)16-30(20,25)4/h15-16,20-22,27H,6-14,17H2,1-5H3/t20?,21?,22?,27?,29?,30?,31-/m1/s1 |
| InChIKey | KTSKCQIVNINUAI-FYGPUFLSSA-N |
| XLogP | 6.13 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |