C32H41NO6 — CID 138654151
dimethyl (4S,4aR,6aS,8aR,14bS)-2-cyano-4,6a,11,11,14b-pentamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a-decahydro-4aH-picene-4,8a-dicarboxylate (PubChem CID 138654151) has the molecular formula C32H41NO6 and a molecular weight of 535.68 g/mol. Its IUPAC name is dimethyl (4S,4aR,6aS,8aR,14bS)-2-cyano-4,6a,11,11,14b-pentamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a-decahydro-4aH-picene-4,8a-dicarboxylate.
| Compound Name | dimethyl (4S,4aR,6aS,8aR,14bS)-2-cyano-4,6a,11,11,14b-pentamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a-decahydro-4aH-picene-4,8a-dicarboxylate |
|---|---|
| PubChem CID | 138654151 |
| Molecular Formula | C32H41NO6 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | dimethyl (4S,4aR,6aS,8aR,14bS)-2-cyano-4,6a,11,11,14b-pentamethyl-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a-decahydro-4aH-picene-4,8a-dicarboxylate |
| SMILES | COC(=O)[C@@]12CCC3C(C(=O)C=C4[C@@]3(C)CC[C@H]3[C@](C)(C(=O)OC)C(=O)C(C#N)=C[C@]43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C32H41NO6/c1-28(2)12-13-32(27(37)39-7)11-8-19-24(20(32)16-28)21(34)14-23-29(19,3)10-9-22-30(23,4)15-18(17-33)25(35)31(22,5)26(36)38-6/h14-15,19-20,22,24H,8-13,16H2,1-7H3/t19?,20?,22-,24?,29+,30+,31+,32-/m1/s1 |
| InChIKey | QDYRRNFVCDCMCM-BFKMRFKTSA-N |
| XLogP | 5.14 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|