C31H39F2NO4 — CID 138653661
methyl (4aR,6bS,9S,12aS)-11-cyano-9-(difluoromethyl)-2,2,6b,9,12a-pentamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 138653661) has the molecular formula C31H39F2NO4 and a molecular weight of 527.65 g/mol. Its IUPAC name is methyl (4aR,6bS,9S,12aS)-11-cyano-9-(difluoromethyl)-2,2,6b,9,12a-pentamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aR,6bS,9S,12aS)-11-cyano-9-(difluoromethyl)-2,2,6b,9,12a-pentamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 138653661 |
| Molecular Formula | C31H39F2NO4 |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | methyl (4aR,6bS,9S,12aS)-11-cyano-9-(difluoromethyl)-2,2,6b,9,12a-pentamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12CCC3C(C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)[C@@](C)(C(F)F)C5CC[C@]43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C31H39F2NO4/c1-27(2)11-12-31(26(37)38-6)10-7-18-23(19(31)15-27)20(35)13-22-28(18,3)9-8-21-29(22,4)14-17(16-34)24(36)30(21,5)25(32)33/h13-14,18-19,21,23,25H,7-12,15H2,1-6H3/t18?,19?,21?,23?,28-,29-,30-,31+/m0/s1 |
| InChIKey | GAJWXWREEQYGJA-VNFWDEAISA-N |
| XLogP | 6.23 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |