C31H45BrO4 — CID 171835062
methane;methyl 11-bromo-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 171835062) has the molecular formula C31H45BrO4 and a molecular weight of 561.60 g/mol. Its IUPAC name is methane;methyl 11-bromo-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | methane;methyl 11-bromo-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 171835062 |
| Molecular Formula | C31H45BrO4 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | methane;methyl 11-bromo-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | C.COC(=O)C12CCC3C(C(=O)C=C4C5(C)C=C(Br)C(=O)C(C)(C)C5CCC43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C30H41BrO4.CH4/c1-26(2)12-13-30(25(34)35-7)11-8-17-23(18(30)15-26)20(32)14-22-28(17,5)10-9-21-27(3,4)24(33)19(31)16-29(21,22)6;/h14,16-18,21,23H,8-13,15H2,1-7H3;1H4 |
| InChIKey | QXRLHGYRNHWTRJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|