C31H43NO7S — CID 143902469
methyl 2,2,6b,9,12a-pentamethyl-11-(methylsulfonylcarbamoyl)-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicene-4a-carboxylate (PubChem CID 143902469) has the molecular formula C31H43NO7S and a molecular weight of 573.75 g/mol. Its IUPAC name is methyl 2,2,6b,9,12a-pentamethyl-11-(methylsulfonylcarbamoyl)-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicene-4a-carboxylate.
| Compound Name | methyl 2,2,6b,9,12a-pentamethyl-11-(methylsulfonylcarbamoyl)-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 143902469 |
| Molecular Formula | C31H43NO7S |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | methyl 2,2,6b,9,12a-pentamethyl-11-(methylsulfonylcarbamoyl)-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicene-4a-carboxylate |
| SMILES | COC(=O)C12CCC3C(C(=O)C=C4C5(C)C=C(C(=O)NS(C)(=O)=O)C(=O)C(C)C5CCC43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C31H43NO7S/c1-17-19-8-10-29(4)20-9-11-31(27(36)39-6)13-12-28(2,3)16-21(31)24(20)22(33)14-23(29)30(19,5)15-18(25(17)34)26(35)32-40(7,37)38/h14-15,17,19-21,24H,8-13,16H2,1-7H3,(H,32,35) |
| InChIKey | PWYNBYIJQWKDMR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|