C30H44O4 — CID 138567976
methyl (4aS,6aR,6bS,9S,12aS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picene-4a-carboxylate (PubChem CID 138567976) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,9S,12aS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,9S,12aS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 138567976 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | methyl (4aS,6aR,6bS,9S,12aS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)CCC(=O)[C@@H](C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C30H44O4/c1-18-19-8-11-28(5)23(27(19,4)10-9-21(18)31)16-22(32)24-20-17-26(2,3)12-14-30(20,25(33)34-7)15-13-29(24,28)6/h16,18-20,24H,8-15,17H2,1-7H3/t18-,19?,20?,24?,27-,28+,29+,30-/m0/s1 |
| InChIKey | MJZCZUJFTUEKRK-SPISBLNJSA-N |
| XLogP | 6.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |