C32H48O3 — CID 88988450
methyl (4aS,6aR,6bS,8aS,12aS,14aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-methylidene-14-oxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate (PubChem CID 88988450) has the molecular formula C32H48O3 and a molecular weight of 480.73 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,8aS,12aS,14aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-methylidene-14-oxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,8aS,12aS,14aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-methylidene-14-oxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 88988450 |
| Molecular Formula | C32H48O3 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | methyl (4aS,6aR,6bS,8aS,12aS,14aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-methylidene-14-oxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate |
| SMILES | C=C1CC[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C(=O)OC)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C32H48O3/c1-20-10-12-29(6)23(28(20,4)5)11-13-30(7)24(29)18-22(33)25-21-19-27(2,3)14-16-32(21,26(34)35-9)17-15-31(25,30)8/h18,21,23,25H,1,10-17,19H2,2-9H3/t21-,23-,25-,29-,30+,31+,32-/m0/s1 |
| InChIKey | RLRMUTGIBBWMBL-MBNGYSSASA-N |
| XLogP | 7.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|