C34H47NO5 — CID 70921155
methyl (4aS,6aR,6bS,8aR,12aS)-10-acetyloxy-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-14-oxo-3,4,5,6,7,8,8a,12,14a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 70921155) has the molecular formula C34H47NO5 and a molecular weight of 549.75 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,8aR,12aS)-10-acetyloxy-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-14-oxo-3,4,5,6,7,8,8a,12,14a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,8aR,12aS)-10-acetyloxy-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-14-oxo-3,4,5,6,7,8,8a,12,14a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 70921155 |
| Molecular Formula | C34H47NO5 |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | methyl (4aS,6aR,6bS,8aR,12aS)-10-acetyloxy-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-14-oxo-3,4,5,6,7,8,8a,12,14a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)CC(C#N)=C(OC(C)=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C34H47NO5/c1-20(36)40-27-21(19-35)17-31(6)24(30(27,4)5)10-11-32(7)25(31)16-23(37)26-22-18-29(2,3)12-14-34(22,28(38)39-9)15-13-33(26,32)8/h16,22,24,26H,10-15,17-18H2,1-9H3/t22?,24-,26?,31-,32+,33+,34-/m0/s1 |
| InChIKey | XYJOLJIKMNRJJH-BRIYRCOXSA-N |
| XLogP | 7.09 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |