C33H50O4 — CID 70812027
ethyl 3-[(4aR,6aR,6bS,8aS,9S,12aS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picen-4a-yl]propanoate (PubChem CID 70812027) has the molecular formula C33H50O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is ethyl 3-[(4aR,6aR,6bS,8aS,9S,12aS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picen-4a-yl]propanoate.
| Compound Name | ethyl 3-[(4aR,6aR,6bS,8aS,9S,12aS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picen-4a-yl]propanoate |
|---|---|
| PubChem CID | 70812027 |
| Molecular Formula | C33H50O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | ethyl 3-[(4aR,6aR,6bS,8aS,9S,12aS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picen-4a-yl]propanoate |
| SMILES | CCOC(=O)CC[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)CCC(=O)[C@@H](C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H50O4/c1-8-37-27(36)11-14-33-17-15-29(3,4)20-23(33)28-25(35)19-26-30(5)12-10-24(34)21(2)22(30)9-13-31(26,6)32(28,7)16-18-33/h19,21-23,28H,8-18,20H2,1-7H3/t21-,22-,23?,28?,30-,31+,32+,33+/m0/s1 |
| InChIKey | RORQXNCRICTADF-AJSJNYBASA-N |
| XLogP | 7.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |