C32H43NO4 — CID 88988427
3-[(4aR,6aR,6bS,8aS,9S,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]propanoic acid (PubChem CID 88988427) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is 3-[(4aR,6aR,6bS,8aS,9S,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]propanoic acid.
| Compound Name | 3-[(4aR,6aR,6bS,8aS,9S,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]propanoic acid |
|---|---|
| PubChem CID | 88988427 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 3-[(4aR,6aR,6bS,8aS,9S,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]propanoic acid |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(CCC(=O)O)CC[C@@]4(C)[C@]3(C)CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C32H43NO4/c1-19-20-8-10-30(5)24(29(20,4)18-22(33-7)27(19)37)16-23(34)26-21-17-28(2,3)12-14-32(21,11-9-25(35)36)15-13-31(26,30)6/h16,18-21,26H,8-15,17H2,1-6H3,(H,35,36)/t19-,20-,21-,26-,29-,30+,31+,32+/m0/s1 |
| InChIKey | AKSSNYURWCJYGK-KPJBCFBOSA-N |
| XLogP | 7.03 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|