C32H41NO5 — CID 88988462
acetyl (4aS,6aR,6bS,8aS,9S,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 88988462) has the molecular formula C32H41NO5 and a molecular weight of 519.68 g/mol. Its IUPAC name is acetyl (4aS,6aR,6bS,8aS,9S,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | acetyl (4aS,6aR,6bS,8aS,9S,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 88988462 |
| Molecular Formula | C32H41NO5 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | acetyl (4aS,6aR,6bS,8aS,9S,12aR,14aR,14bS)-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C(=O)OC(C)=O)CC[C@@]4(C)[C@]3(C)CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C32H41NO5/c1-18-20-9-10-30(6)24(29(20,5)17-22(33-8)26(18)36)15-23(35)25-21-16-28(3,4)11-13-32(21,14-12-31(25,30)7)27(37)38-19(2)34/h15,17-18,20-21,25H,9-14,16H2,1-7H3/t18-,20-,21-,25-,29-,30+,31+,32-/m0/s1 |
| InChIKey | SJMXAVSHOLOTQY-IFLIQJACSA-N |
| XLogP | 6.26 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|