C35H48N2O4 — CID 66546388
3-[(4aR,6aR,6bS,8aS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]-N-(oxetan-3-yl)propanamide (PubChem CID 66546388) has the molecular formula C35H48N2O4 and a molecular weight of 560.78 g/mol. Its IUPAC name is 3-[(4aR,6aR,6bS,8aS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]-N-(oxetan-3-yl)propanamide.
| Compound Name | 3-[(4aR,6aR,6bS,8aS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]-N-(oxetan-3-yl)propanamide |
|---|---|
| PubChem CID | 66546388 |
| Molecular Formula | C35H48N2O4 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.36 |
| IUPAC Name | 3-[(4aR,6aR,6bS,8aS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]-N-(oxetan-3-yl)propanamide |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)C4C5CC(C)(C)CC[C@]5(CCC(=O)NC5COC5)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C35H48N2O4/c1-21-24-7-9-33(5)27(32(24,4)16-22(18-36)30(21)40)15-26(38)29-25-17-31(2,3)11-13-35(25,14-12-34(29,33)6)10-8-28(39)37-23-19-41-20-23/h15-16,21,23-25,29H,7-14,17,19-20H2,1-6H3,(H,37,39)/t21-,24-,25?,29?,32-,33+,34+,35+/m0/s1 |
| InChIKey | AXKFILHGWTYYJN-WDLPPRDKSA-N |
| XLogP | 6.11 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |