C33H48N2O2 — CID 138568118
3-[(4aR,6aR,6bS,8aS,9R,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-1,3,4,5,6,7,8,8a,9,10,14a,14b-dodecahydropicen-4a-yl]-N-methylpropanamide (PubChem CID 138568118) has the molecular formula C33H48N2O2 and a molecular weight of 504.76 g/mol. Its IUPAC name is 3-[(4aR,6aR,6bS,8aS,9R,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-1,3,4,5,6,7,8,8a,9,10,14a,14b-dodecahydropicen-4a-yl]-N-methylpropanamide.
| Compound Name | 3-[(4aR,6aR,6bS,8aS,9R,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-1,3,4,5,6,7,8,8a,9,10,14a,14b-dodecahydropicen-4a-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 138568118 |
| Molecular Formula | C33H48N2O2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | 3-[(4aR,6aR,6bS,8aS,9R,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-1,3,4,5,6,7,8,8a,9,10,14a,14b-dodecahydropicen-4a-yl]-N-methylpropanamide |
| SMILES | CNC(=O)CC[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)C=C(C#N)C[C@@H](C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H48N2O2/c1-21-16-22(20-34)18-30(4)23(21)8-10-31(5)26(30)17-25(36)28-24-19-29(2,3)12-14-33(24,11-9-27(37)35-7)15-13-32(28,31)6/h17-18,21,23-24,28H,8-16,19H2,1-7H3,(H,35,37)/t21-,23+,24?,28?,30+,31-,32-,33-/m1/s1 |
| InChIKey | HYHQPMMBTRAVRG-IGZKRICBSA-N |
| XLogP | 7.16 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |