C35H50N2O3 — CID 126514018
3-[(1S,2R,5R,15R,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-5-hexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-enyl]-N-methylpropanamide (PubChem CID 126514018) has the molecular formula C35H50N2O3 and a molecular weight of 546.80 g/mol. Its IUPAC name is 3-[(1S,2R,5R,15R,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-5-hexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-enyl]-N-methylpropanamide.
| Compound Name | 3-[(1S,2R,5R,15R,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-5-hexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-enyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 126514018 |
| Molecular Formula | C35H50N2O3 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | 3-[(1S,2R,5R,15R,16R,18R,21R)-18-cyano-1,2,8,8,15,20,20-heptamethyl-12,19-dioxo-5-hexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-13-enyl]-N-methylpropanamide |
| SMILES | CNC(=O)CC[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)[C@H]5C[C@@]5(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C35H50N2O3/c1-29(2)13-15-34(12-10-26(39)37-8)16-14-32(6)27(21(34)18-29)22(38)17-24-31(32,5)11-9-23-30(3,4)28(40)35(20-36)19-25(35)33(23,24)7/h17,21,23,25,27H,9-16,18-19H2,1-8H3,(H,37,39)/t21?,23-,25+,27?,31+,32+,33-,34+,35-/m0/s1 |
| InChIKey | SUAKFJATZJRMFH-DASSMASZSA-N |
| XLogP | 6.81 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |