C34H46INO4 — CID 88949033
3-[(4aR,6aR,6bS,8aS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]propyl 2-iodoacetate (PubChem CID 88949033) has the molecular formula C34H46INO4 and a molecular weight of 659.65 g/mol. Its IUPAC name is 3-[(4aR,6aR,6bS,8aS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]propyl 2-iodoacetate.
| Compound Name | 3-[(4aR,6aR,6bS,8aS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]propyl 2-iodoacetate |
|---|---|
| PubChem CID | 88949033 |
| Molecular Formula | C34H46INO4 |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | 3-[(4aR,6aR,6bS,8aS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]propyl 2-iodoacetate |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)C4C5CC(C)(C)CC[C@]5(CCCOC(=O)CI)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C34H46INO4/c1-21-23-8-10-32(5)26(31(23,4)17-22(20-36)29(21)39)16-25(37)28-24-18-30(2,3)11-13-34(24,14-12-33(28,32)6)9-7-15-40-27(38)19-35/h16-17,21,23-24,28H,7-15,18-19H2,1-6H3/t21-,23-,24?,28?,31-,32+,33+,34+/m0/s1 |
| InChIKey | AQVALVOBPOTUAZ-MVUJNYOESA-N |
| XLogP | 7.57 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|