C29H42O4 — CID 70808130
(4aS,6aR,6bS,8aS,9S,12aS,14aR,14bS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picene-4a-carboxylic acid (PubChem CID 70808130) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is (4aS,6aR,6bS,8aS,9S,12aS,14aR,14bS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | (4aS,6aR,6bS,8aS,9S,12aS,14aR,14bS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 70808130 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (4aS,6aR,6bS,8aS,9S,12aS,14aR,14bS)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,11,12,14a,14b-dodecahydro-1H-picene-4a-carboxylic acid |
| SMILES | C[C@@H]1C(=O)CC[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C(=O)O)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C29H42O4/c1-17-18-7-10-27(5)22(26(18,4)9-8-20(17)30)15-21(31)23-19-16-25(2,3)11-13-29(19,24(32)33)14-12-28(23,27)6/h15,17-19,23H,7-14,16H2,1-6H3,(H,32,33)/t17-,18-,19-,23-,26-,27+,28+,29-/m0/s1 |
| InChIKey | RGTSVNPJPABAGF-QSUKNTSOSA-N |
| XLogP | 6.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |