C30H42O4 — CID 59975547
(6aR,6bS,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylic acid (PubChem CID 59975547) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is (6aR,6bS,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylic acid.
| Compound Name | (6aR,6bS,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 59975547 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | (6aR,6bS,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CCC2(C(=O)O)CC[C@]3(C)C(C(=O)C=C4[C@@]5(C)C=CC(=O)C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C30H42O4/c1-25(2)12-14-30(24(33)34)15-13-29(7)23(18(30)17-25)19(31)16-21-27(5)10-9-22(32)26(3,4)20(27)8-11-28(21,29)6/h9-10,16,18,20,23H,8,11-15,17H2,1-7H3,(H,33,34)/t18?,20?,23?,27-,28+,29+,30?/m0/s1 |
| InChIKey | FQENJHAAXSFPAJ-FMCUQBMESA-N |
| XLogP | 6.40 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |