C31H42N2O2 — CID 143681024
4,6a,11,11,14b-pentamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2,8a-dicarbonitrile;ethane (PubChem CID 143681024) has the molecular formula C31H42N2O2 and a molecular weight of 474.69 g/mol. Its IUPAC name is 4,6a,11,11,14b-pentamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2,8a-dicarbonitrile;ethane.
| Compound Name | 4,6a,11,11,14b-pentamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2,8a-dicarbonitrile;ethane |
|---|---|
| PubChem CID | 143681024 |
| Molecular Formula | C31H42N2O2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 4,6a,11,11,14b-pentamethyl-3,13-dioxo-4,4a,5,6,6a,6b,7,8,9,10,12,12a-dodecahydropicene-2,8a-dicarbonitrile;ethane |
| SMILES | CC.CC1C(=O)C(C#N)=CC2(C)C3=CC(=O)C4C5CC(C)(C)CCC5(C#N)CCC4C3(C)CCC12 |
| InChI | InChI=1S/C29H36N2O2.C2H6/c1-17-19-6-8-27(4)20-7-9-29(16-31)11-10-26(2,3)14-21(29)24(20)22(32)12-23(27)28(19,5)13-18(15-30)25(17)33;1-2/h12-13,17,19-21,24H,6-11,14H2,1-5H3;1-2H3 |
| InChIKey | ANXWXXRQHCPPNL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |