C30H40N2O2 — CID 143880691
4,4,6a,11,11,14b-hexamethyl-8a-(methylideneamino)-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a-decahydro-4aH-picene-2-carbonitrile (PubChem CID 143880691) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is 4,4,6a,11,11,14b-hexamethyl-8a-(methylideneamino)-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a-decahydro-4aH-picene-2-carbonitrile.
| Compound Name | 4,4,6a,11,11,14b-hexamethyl-8a-(methylideneamino)-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a-decahydro-4aH-picene-2-carbonitrile |
|---|---|
| PubChem CID | 143880691 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 4,4,6a,11,11,14b-hexamethyl-8a-(methylideneamino)-3,13-dioxo-5,6,6a,6b,7,8,9,10,12,12a-decahydro-4aH-picene-2-carbonitrile |
| SMILES | C=NC12CCC3C(C(=O)C=C4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C30H40N2O2/c1-26(2)12-13-30(32-7)11-8-19-24(20(30)16-26)21(33)14-23-28(19,5)10-9-22-27(3,4)25(34)18(17-31)15-29(22,23)6/h14-15,19-20,22,24H,7-13,16H2,1-6H3 |
| InChIKey | FXONSOORRRANCS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 70.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|