C31H42N2O4 — CID 138653668
methyl N-[(4aR,6bS,12aS)-11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl]carbamate (PubChem CID 138653668) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is methyl N-[(4aR,6bS,12aS)-11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl]carbamate.
| Compound Name | methyl N-[(4aR,6bS,12aS)-11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl]carbamate |
|---|---|
| PubChem CID | 138653668 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | methyl N-[(4aR,6bS,12aS)-11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl]carbamate |
| SMILES | COC(=O)N[C@@]12CCC3C(C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)C5CC[C@]43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C31H42N2O4/c1-27(2)12-13-31(33-26(36)37-7)11-8-19-24(20(31)16-27)21(34)14-23-29(19,5)10-9-22-28(3,4)25(35)18(17-32)15-30(22,23)6/h14-15,19-20,22,24H,8-13,16H2,1-7H3,(H,33,36)/t19?,20?,22?,24?,29-,30-,31+/m0/s1 |
| InChIKey | AXVXHHYCDAZYDI-IZFKJVDZSA-N |
| XLogP | 5.92 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |