C32H43NO4 — CID 144586899
(11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl)methyl acetate (PubChem CID 144586899) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is (11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl)methyl acetate.
| Compound Name | (11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl)methyl acetate |
|---|---|
| PubChem CID | 144586899 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | (11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl)methyl acetate |
| SMILES | CC(=O)OCC12CCC3C(C(=O)C=C4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C32H43NO4/c1-19(34)37-18-32-11-8-21-26(22(32)16-28(2,3)12-13-32)23(35)14-25-30(21,6)10-9-24-29(4,5)27(36)20(17-33)15-31(24,25)7/h14-15,21-22,24,26H,8-13,16,18H2,1-7H3 |
| InChIKey | XKEOCFNYQWBOLB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |