C35H50N2O4 — CID 144797089
3-(11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl)propyl N-ethylcarbamate (PubChem CID 144797089) has the molecular formula C35H50N2O4 and a molecular weight of 562.80 g/mol. Its IUPAC name is 3-(11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl)propyl N-ethylcarbamate.
| Compound Name | 3-(11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl)propyl N-ethylcarbamate |
|---|---|
| PubChem CID | 144797089 |
| Molecular Formula | C35H50N2O4 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | 3-(11-cyano-2,2,6b,9,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,6a,7,8,8a,14a,14b-decahydro-1H-picen-4a-yl)propyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCCC12CCC3C(C(=O)C=C4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C35H50N2O4/c1-8-37-30(40)41-17-9-12-35-14-10-23-28(24(35)20-31(2,3)15-16-35)25(38)18-27-33(23,6)13-11-26-32(4,5)29(39)22(21-36)19-34(26,27)7/h18-19,23-24,26,28H,8-17,20H2,1-7H3,(H,37,40) |
| InChIKey | UCELPWXVBIRRCA-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|