C22H33NO2 — CID 142265769
1,4a,8a-trimethyl-2,6-dioxo-1,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile;ethane (PubChem CID 142265769) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 1,4a,8a-trimethyl-2,6-dioxo-1,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile;ethane.
| Compound Name | 1,4a,8a-trimethyl-2,6-dioxo-1,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 142265769 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 1,4a,8a-trimethyl-2,6-dioxo-1,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile;ethane |
| SMILES | CC.CC.CC1C(=O)C(C#N)=CC2(C)C3=CC(=O)CCC3(C)CCC12 |
| InChI | InChI=1S/C18H21NO2.2C2H6/c1-11-14-5-7-17(2)6-4-13(20)8-15(17)18(14,3)9-12(10-19)16(11)21;2*1-2/h8-9,11,14H,4-7H2,1-3H3;2*1-2H3 |
| InChIKey | OQFZIUYFOWOAOR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |