C22H33NO3 — CID 142265776
ethane;8-hydroxy-1,4a,8a-trimethyl-2,6-dioxo-1,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile (PubChem CID 142265776) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is ethane;8-hydroxy-1,4a,8a-trimethyl-2,6-dioxo-1,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile.
| Compound Name | ethane;8-hydroxy-1,4a,8a-trimethyl-2,6-dioxo-1,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 142265776 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | ethane;8-hydroxy-1,4a,8a-trimethyl-2,6-dioxo-1,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile |
| SMILES | CC.CC.CC1C(=O)C(C#N)=CC2(C)C3=CC(=O)CC(O)C3(C)CCC12 |
| InChI | InChI=1S/C18H21NO3.2C2H6/c1-10-13-4-5-17(2)14(6-12(20)7-15(17)21)18(13,3)8-11(9-19)16(10)22;2*1-2/h6,8,10,13,15,21H,4-5,7H2,1-3H3;2*1-2H3 |
| InChIKey | GVEFWPRSPNQMAC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |